C26H31N3O5 — CID 108935012
1-benzyl-4-[4-(3,4-dimethoxybenzoyl)-1,4-diazepane-1-carbonyl]pyrrolidin-2-one (PubChem CID 108935012) has the molecular formula C26H31N3O5 and a molecular weight of 465.55 g/mol. Its IUPAC name is 1-benzyl-4-[4-(3,4-dimethoxybenzoyl)-1,4-diazepane-1-carbonyl]pyrrolidin-2-one.
| Compound Name | 1-benzyl-4-[4-(3,4-dimethoxybenzoyl)-1,4-diazepane-1-carbonyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 108935012 |
| Molecular Formula | C26H31N3O5 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | 1-benzyl-4-[4-(3,4-dimethoxybenzoyl)-1,4-diazepane-1-carbonyl]pyrrolidin-2-one |
| SMILES | COc1ccc(C(=O)N2CCCN(C(=O)C3CC(=O)N(Cc4ccccc4)C3)CC2)cc1OC |
| InChI | InChI=1S/C26H31N3O5/c1-33-22-10-9-20(15-23(22)34-2)25(31)27-11-6-12-28(14-13-27)26(32)21-16-24(30)29(18-21)17-19-7-4-3-5-8-19/h3-5,7-10,15,21H,6,11-14,16-18H2,1-2H3 |
| InChIKey | QASVLYQZGUBPFH-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |