C24H27N3O3S — CID 108546297
1-benzyl-4-[4-(2-sulfanylbenzoyl)-1,4-diazepane-1-carbonyl]pyrrolidin-2-one (PubChem CID 108546297) has the molecular formula C24H27N3O3S and a molecular weight of 437.57 g/mol. Its IUPAC name is 1-benzyl-4-[4-(2-sulfanylbenzoyl)-1,4-diazepane-1-carbonyl]pyrrolidin-2-one.
| Compound Name | 1-benzyl-4-[4-(2-sulfanylbenzoyl)-1,4-diazepane-1-carbonyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 108546297 |
| Molecular Formula | C24H27N3O3S |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | 1-benzyl-4-[4-(2-sulfanylbenzoyl)-1,4-diazepane-1-carbonyl]pyrrolidin-2-one |
| SMILES | O=C1CC(C(=O)N2CCCN(C(=O)c3ccccc3S)CC2)CN1Cc1ccccc1 |
| InChI | InChI=1S/C24H27N3O3S/c28-22-15-19(17-27(22)16-18-7-2-1-3-8-18)23(29)25-11-6-12-26(14-13-25)24(30)20-9-4-5-10-21(20)31/h1-5,7-10,19,31H,6,11-17H2 |
| InChIKey | SKJQADFZFWFYCB-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 60.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|