About 2-morpholin-4-ylethyl 2-phenoxypyridine-4-carboxylate
2-morpholin-4-ylethyl 2-phenoxypyridine-4-carboxylate (PubChem CID 167823575) has the molecular formula C18H20N2O4
and a molecular weight of 328.37 g/mol. Its IUPAC name is 2-morpholin-4-ylethyl 2-phenoxypyridine-4-carboxylate.
Molecular Properties
| Compound Name | 2-morpholin-4-ylethyl 2-phenoxypyridine-4-carboxylate |
| PubChem CID | 167823575 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 2-morpholin-4-ylethyl 2-phenoxypyridine-4-carboxylate |
| SMILES | O=C(OCCN1CCOCC1)c1ccnc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C18H20N2O4/c21-18(23-13-10-20-8-11-22-12-9-20)15-6-7-19-17(14-15)24-16-4-2-1-3-5-16/h1-7,14H,8-13H2 |
| InChIKey | NBBDZWSFIZNZMY-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-morpholin-4-ylethyl 2-phenoxypyridine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-morpholin-4-ylethyl 2-phenoxypyridine-4-carboxylate?
The IUPAC name of 2-morpholin-4-ylethyl 2-phenoxypyridine-4-carboxylate (CID 167823575) is 2-morpholin-4-ylethyl 2-phenoxypyridine-4-carboxylate.
What is the SMILES notation for 2-morpholin-4-ylethyl 2-phenoxypyridine-4-carboxylate?
The canonical SMILES for 2-morpholin-4-ylethyl 2-phenoxypyridine-4-carboxylate is O=C(OCCN1CCOCC1)c1ccnc(Oc2ccccc2)c1.
What is the InChIKey of 2-morpholin-4-ylethyl 2-phenoxypyridine-4-carboxylate?
The InChIKey is NBBDZWSFIZNZMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N2O4/c21-18(23-13-10-20-8-11-22-12-9-20)15-6-7-19-17(14-15)24-16-4-2-1-3-5-16/h1-7,14H,8-13H2.
What are the key properties of 2-morpholin-4-ylethyl 2-phenoxypyridine-4-carboxylate?
2-morpholin-4-ylethyl 2-phenoxypyridine-4-carboxylate has a molecular weight of 328.37 g/mol, XLogP of 2.36, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-morpholin-4-ylethyl 2-phenoxypyridine-4-carboxylate is sourced from PubChem (CID 167823575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).