About 2-morpholin-4-ylethyl 4-fluoro-3-(1-phenylcyclopentyl)oxycarbonyloxybenzoate
2-morpholin-4-ylethyl 4-fluoro-3-(1-phenylcyclopentyl)oxycarbonyloxybenzoate (PubChem CID 171607901) has the molecular formula C25H28FNO6
and a molecular weight of 457.50 g/mol. Its IUPAC name is 2-morpholin-4-ylethyl 4-fluoro-3-(1-phenylcyclopentyl)oxycarbonyloxybenzoate.
Molecular Properties
| Compound Name | 2-morpholin-4-ylethyl 4-fluoro-3-(1-phenylcyclopentyl)oxycarbonyloxybenzoate |
| PubChem CID | 171607901 |
| Molecular Formula | C25H28FNO6 |
| Molecular Weight | 457.50 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | 2-morpholin-4-ylethyl 4-fluoro-3-(1-phenylcyclopentyl)oxycarbonyloxybenzoate |
| SMILES | O=C(Oc1cc(C(=O)OCCN2CCOCC2)ccc1F)OC1(c2ccccc2)CCCC1 |
| InChI | InChI=1S/C25H28FNO6/c26-21-9-8-19(23(28)31-17-14-27-12-15-30-16-13-27)18-22(21)32-24(29)33-25(10-4-5-11-25)20-6-2-1-3-7-20/h1-3,6-9,18H,4-5,10-17H2 |
| InChIKey | IETYGOAWKDHBTE-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 457.50 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze 2-morpholin-4-ylethyl 4-fluoro-3-(1-phenylcyclopentyl)oxycarbonyloxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-morpholin-4-ylethyl 4-fluoro-3-(1-phenylcyclopentyl)oxycarbonyloxybenzoate?
The IUPAC name of 2-morpholin-4-ylethyl 4-fluoro-3-(1-phenylcyclopentyl)oxycarbonyloxybenzoate (CID 171607901) is 2-morpholin-4-ylethyl 4-fluoro-3-(1-phenylcyclopentyl)oxycarbonyloxybenzoate.
What is the SMILES notation for 2-morpholin-4-ylethyl 4-fluoro-3-(1-phenylcyclopentyl)oxycarbonyloxybenzoate?
The canonical SMILES for 2-morpholin-4-ylethyl 4-fluoro-3-(1-phenylcyclopentyl)oxycarbonyloxybenzoate is O=C(Oc1cc(C(=O)OCCN2CCOCC2)ccc1F)OC1(c2ccccc2)CCCC1.
What is the InChIKey of 2-morpholin-4-ylethyl 4-fluoro-3-(1-phenylcyclopentyl)oxycarbonyloxybenzoate?
The InChIKey is IETYGOAWKDHBTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H28FNO6/c26-21-9-8-19(23(28)31-17-14-27-12-15-30-16-13-27)18-22(21)32-24(29)33-25(10-4-5-11-25)20-6-2-1-3-7-20/h1-3,6-9,18H,4-5,10-17H2.
What are the key properties of 2-morpholin-4-ylethyl 4-fluoro-3-(1-phenylcyclopentyl)oxycarbonyloxybenzoate?
2-morpholin-4-ylethyl 4-fluoro-3-(1-phenylcyclopentyl)oxycarbonyloxybenzoate has a molecular weight of 457.50 g/mol, XLogP of 4.30, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-morpholin-4-ylethyl 4-fluoro-3-(1-phenylcyclopentyl)oxycarbonyloxybenzoate is sourced from PubChem (CID 171607901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).