About 2-morpholin-4-ylethyl 3-amino-4-methoxybenzoate
2-morpholin-4-ylethyl 3-amino-4-methoxybenzoate (PubChem CID 61321668) has the molecular formula C14H20N2O4
and a molecular weight of 280.32 g/mol. Its IUPAC name is 2-morpholin-4-ylethyl 3-amino-4-methoxybenzoate.
Molecular Properties
| Compound Name | 2-morpholin-4-ylethyl 3-amino-4-methoxybenzoate |
| PubChem CID | 61321668 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 2-morpholin-4-ylethyl 3-amino-4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OCCN2CCOCC2)cc1N |
| InChI | InChI=1S/C14H20N2O4/c1-18-13-3-2-11(10-12(13)15)14(17)20-9-6-16-4-7-19-8-5-16/h2-3,10H,4-9,15H2,1H3 |
| InChIKey | GGYKGFRFONZPGT-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-morpholin-4-ylethyl 3-amino-4-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-morpholin-4-ylethyl 3-amino-4-methoxybenzoate?
The IUPAC name of 2-morpholin-4-ylethyl 3-amino-4-methoxybenzoate (CID 61321668) is 2-morpholin-4-ylethyl 3-amino-4-methoxybenzoate.
What is the SMILES notation for 2-morpholin-4-ylethyl 3-amino-4-methoxybenzoate?
The canonical SMILES for 2-morpholin-4-ylethyl 3-amino-4-methoxybenzoate is COc1ccc(C(=O)OCCN2CCOCC2)cc1N.
What is the InChIKey of 2-morpholin-4-ylethyl 3-amino-4-methoxybenzoate?
The InChIKey is GGYKGFRFONZPGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O4/c1-18-13-3-2-11(10-12(13)15)14(17)20-9-6-16-4-7-19-8-5-16/h2-3,10H,4-9,15H2,1H3.
What are the key properties of 2-morpholin-4-ylethyl 3-amino-4-methoxybenzoate?
2-morpholin-4-ylethyl 3-amino-4-methoxybenzoate has a molecular weight of 280.32 g/mol, XLogP of 0.77, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-morpholin-4-ylethyl 3-amino-4-methoxybenzoate is sourced from PubChem (CID 61321668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).