About 2-(4-methylpiperazin-1-yl)ethyl 3-amino-4-methylbenzoate
2-(4-methylpiperazin-1-yl)ethyl 3-amino-4-methylbenzoate (PubChem CID 82891746) has the molecular formula C15H23N3O2
and a molecular weight of 277.37 g/mol. Its IUPAC name is 2-(4-methylpiperazin-1-yl)ethyl 3-amino-4-methylbenzoate.
Molecular Properties
| Compound Name | 2-(4-methylpiperazin-1-yl)ethyl 3-amino-4-methylbenzoate |
| PubChem CID | 82891746 |
| Molecular Formula | C15H23N3O2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | 2-(4-methylpiperazin-1-yl)ethyl 3-amino-4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OCCN2CCN(C)CC2)cc1N |
| InChI | InChI=1S/C15H23N3O2/c1-12-3-4-13(11-14(12)16)15(19)20-10-9-18-7-5-17(2)6-8-18/h3-4,11H,5-10,16H2,1-2H3 |
| InChIKey | ZFCHNVUFDPIPFC-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-methylpiperazin-1-yl)ethyl 3-amino-4-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methylpiperazin-1-yl)ethyl 3-amino-4-methylbenzoate?
The IUPAC name of 2-(4-methylpiperazin-1-yl)ethyl 3-amino-4-methylbenzoate (CID 82891746) is 2-(4-methylpiperazin-1-yl)ethyl 3-amino-4-methylbenzoate.
What is the SMILES notation for 2-(4-methylpiperazin-1-yl)ethyl 3-amino-4-methylbenzoate?
The canonical SMILES for 2-(4-methylpiperazin-1-yl)ethyl 3-amino-4-methylbenzoate is Cc1ccc(C(=O)OCCN2CCN(C)CC2)cc1N.
What is the InChIKey of 2-(4-methylpiperazin-1-yl)ethyl 3-amino-4-methylbenzoate?
The InChIKey is ZFCHNVUFDPIPFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N3O2/c1-12-3-4-13(11-14(12)16)15(19)20-10-9-18-7-5-17(2)6-8-18/h3-4,11H,5-10,16H2,1-2H3.
What are the key properties of 2-(4-methylpiperazin-1-yl)ethyl 3-amino-4-methylbenzoate?
2-(4-methylpiperazin-1-yl)ethyl 3-amino-4-methylbenzoate has a molecular weight of 277.37 g/mol, XLogP of 0.98, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methylpiperazin-1-yl)ethyl 3-amino-4-methylbenzoate is sourced from PubChem (CID 82891746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).