C14H22N4O2 — CID 82891589
2-(4-methylpiperazin-1-yl)ethyl 2,4-diaminobenzoate (PubChem CID 82891589) has the molecular formula C14H22N4O2 and a molecular weight of 278.36 g/mol. Its IUPAC name is 2-(4-methylpiperazin-1-yl)ethyl 2,4-diaminobenzoate.
| Compound Name | 2-(4-methylpiperazin-1-yl)ethyl 2,4-diaminobenzoate |
|---|---|
| PubChem CID | 82891589 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 2-(4-methylpiperazin-1-yl)ethyl 2,4-diaminobenzoate |
| SMILES | CN1CCN(CCOC(=O)c2ccc(N)cc2N)CC1 |
| InChI | InChI=1S/C14H22N4O2/c1-17-4-6-18(7-5-17)8-9-20-14(19)12-3-2-11(15)10-13(12)16/h2-3,10H,4-9,15-16H2,1H3 |
| InChIKey | NICIZURZAPDQTN-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 84.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|