C20H17F3O5 — CID 170685941
3-(1-phenylcyclopentyl)oxycarbonyloxy-4-(trifluoromethyl)benzoic acid (PubChem CID 170685941) has the molecular formula C20H17F3O5 and a molecular weight of 394.35 g/mol. Its IUPAC name is 3-(1-phenylcyclopentyl)oxycarbonyloxy-4-(trifluoromethyl)benzoic acid.
| Compound Name | 3-(1-phenylcyclopentyl)oxycarbonyloxy-4-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 170685941 |
| Molecular Formula | C20H17F3O5 |
| Molecular Weight | 394.35 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | 3-(1-phenylcyclopentyl)oxycarbonyloxy-4-(trifluoromethyl)benzoic acid |
| SMILES | O=C(Oc1cc(C(=O)O)ccc1C(F)(F)F)OC1(c2ccccc2)CCCC1 |
| InChI | InChI=1S/C20H17F3O5/c21-20(22,23)15-9-8-13(17(24)25)12-16(15)27-18(26)28-19(10-4-5-11-19)14-6-2-1-3-7-14/h1-3,6-9,12H,4-5,10-11H2,(H,24,25) |
| InChIKey | MHAYNLOEHUESQE-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.35 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|