C22H18F3O3- — CID 170686022
3-[1-(2-phenylethynyl)cyclohexyl]oxy-4-(trifluoromethyl)benzoate (PubChem CID 170686022) has the molecular formula C22H18F3O3- and a molecular weight of 387.38 g/mol. Its IUPAC name is 3-[1-(2-phenylethynyl)cyclohexyl]oxy-4-(trifluoromethyl)benzoate.
| Compound Name | 3-[1-(2-phenylethynyl)cyclohexyl]oxy-4-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 170686022 |
| Molecular Formula | C22H18F3O3- |
| Molecular Weight | 387.38 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | 3-[1-(2-phenylethynyl)cyclohexyl]oxy-4-(trifluoromethyl)benzoate |
| SMILES | O=C([O-])c1ccc(C(F)(F)F)c(OC2(C#Cc3ccccc3)CCCCC2)c1 |
| InChI | InChI=1S/C22H19F3O3/c23-22(24,25)18-10-9-17(20(26)27)15-19(18)28-21(12-5-2-6-13-21)14-11-16-7-3-1-4-8-16/h1,3-4,7-10,15H,2,5-6,12-13H2,(H,26,27)/p-1 |
| InChIKey | KPLZLXDLFHLARB-UHFFFAOYSA-M |
| XLogP | 4.20 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.38 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|