C16H16F3O4- — CID 170686106
3-[(2-ethyl-7-oxabicyclo[2.2.1]heptan-2-yl)oxy]-4-(trifluoromethyl)benzoate (PubChem CID 170686106) has the molecular formula C16H16F3O4- and a molecular weight of 329.29 g/mol. Its IUPAC name is 3-[(2-ethyl-7-oxabicyclo[2.2.1]heptan-2-yl)oxy]-4-(trifluoromethyl)benzoate.
| Compound Name | 3-[(2-ethyl-7-oxabicyclo[2.2.1]heptan-2-yl)oxy]-4-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 170686106 |
| Molecular Formula | C16H16F3O4- |
| Molecular Weight | 329.29 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 3-[(2-ethyl-7-oxabicyclo[2.2.1]heptan-2-yl)oxy]-4-(trifluoromethyl)benzoate |
| SMILES | CCC1(Oc2cc(C(=O)[O-])ccc2C(F)(F)F)CC2CCC1O2 |
| InChI | InChI=1S/C16H17F3O4/c1-2-15(8-10-4-6-13(15)22-10)23-12-7-9(14(20)21)3-5-11(12)16(17,18)19/h3,5,7,10,13H,2,4,6,8H2,1H3,(H,20,21)/p-1 |
| InChIKey | KUQJEXFTYCLYPN-UHFFFAOYSA-M |
| XLogP | 2.55 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.29 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |