C13H7F9O3 — CID 86598679
4,4,4-trifluoro-1-[3-(2,2,2-trifluoroethoxy)-4-(trifluoromethyl)phenyl]butane-1,3-dione (PubChem CID 86598679) has the molecular formula C13H7F9O3 and a molecular weight of 382.18 g/mol. Its IUPAC name is 4,4,4-trifluoro-1-[3-(2,2,2-trifluoroethoxy)-4-(trifluoromethyl)phenyl]butane-1,3-dione.
| Compound Name | 4,4,4-trifluoro-1-[3-(2,2,2-trifluoroethoxy)-4-(trifluoromethyl)phenyl]butane-1,3-dione |
|---|---|
| PubChem CID | 86598679 |
| Molecular Formula | C13H7F9O3 |
| Molecular Weight | 382.18 g/mol |
| Exact Mass | 382.03 |
| IUPAC Name | 4,4,4-trifluoro-1-[3-(2,2,2-trifluoroethoxy)-4-(trifluoromethyl)phenyl]butane-1,3-dione |
| SMILES | O=C(CC(=O)C(F)(F)F)c1ccc(C(F)(F)F)c(OCC(F)(F)F)c1 |
| InChI | InChI=1S/C13H7F9O3/c14-11(15,16)5-25-9-3-6(1-2-7(9)12(17,18)19)8(23)4-10(24)13(20,21)22/h1-3H,4-5H2 |
| InChIKey | UUAJZITZZOJNCF-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.18 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|