C23H28F3O4- — CID 170686515
3-[1-(1-adamantylmethoxy)-2-methylpropoxy]-4-(trifluoromethyl)benzoate (PubChem CID 170686515) has the molecular formula C23H28F3O4- and a molecular weight of 425.47 g/mol. Its IUPAC name is 3-[1-(1-adamantylmethoxy)-2-methylpropoxy]-4-(trifluoromethyl)benzoate.
| Compound Name | 3-[1-(1-adamantylmethoxy)-2-methylpropoxy]-4-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 170686515 |
| Molecular Formula | C23H28F3O4- |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | 3-[1-(1-adamantylmethoxy)-2-methylpropoxy]-4-(trifluoromethyl)benzoate |
| SMILES | CC(C)C(OCC12CC3CC(CC(C3)C1)C2)Oc1cc(C(=O)[O-])ccc1C(F)(F)F |
| InChI | InChI=1S/C23H29F3O4/c1-13(2)21(29-12-22-9-14-5-15(10-22)7-16(6-14)11-22)30-19-8-17(20(27)28)3-4-18(19)23(24,25)26/h3-4,8,13-16,21H,5-7,9-12H2,1-2H3,(H,27,28)/p-1 |
| InChIKey | KIXQOQWTXKUUFC-UHFFFAOYSA-M |
| XLogP | 4.66 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|