C21H26NO6- — CID 170686660
3-[1-(2-adamantyloxy)-2-methylpropoxy]-4-nitrobenzoate (PubChem CID 170686660) has the molecular formula C21H26NO6- and a molecular weight of 388.44 g/mol. Its IUPAC name is 3-[1-(2-adamantyloxy)-2-methylpropoxy]-4-nitrobenzoate.
| Compound Name | 3-[1-(2-adamantyloxy)-2-methylpropoxy]-4-nitrobenzoate |
|---|---|
| PubChem CID | 170686660 |
| Molecular Formula | C21H26NO6- |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 3-[1-(2-adamantyloxy)-2-methylpropoxy]-4-nitrobenzoate |
| SMILES | CC(C)C(Oc1cc(C(=O)[O-])ccc1[N+](=O)[O-])OC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C21H27NO6/c1-11(2)21(27-18-10-14(20(23)24)3-4-17(18)22(25)26)28-19-15-6-12-5-13(8-15)9-16(19)7-12/h3-4,10-13,15-16,19,21H,5-9H2,1-2H3,(H,23,24)/p-1 |
| InChIKey | DGERTVYEVLVGCC-UHFFFAOYSA-M |
| XLogP | 3.16 |
| TPSA | 101.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|