C18H22NO5- — CID 170686650
3-(1-cyclohexylcyclopentyl)oxy-4-nitrobenzoate (PubChem CID 170686650) has the molecular formula C18H22NO5- and a molecular weight of 332.38 g/mol. Its IUPAC name is 3-(1-cyclohexylcyclopentyl)oxy-4-nitrobenzoate.
| Compound Name | 3-(1-cyclohexylcyclopentyl)oxy-4-nitrobenzoate |
|---|---|
| PubChem CID | 170686650 |
| Molecular Formula | C18H22NO5- |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 3-(1-cyclohexylcyclopentyl)oxy-4-nitrobenzoate |
| SMILES | O=C([O-])c1ccc([N+](=O)[O-])c(OC2(C3CCCCC3)CCCC2)c1 |
| InChI | InChI=1S/C18H23NO5/c20-17(21)13-8-9-15(19(22)23)16(12-13)24-18(10-4-5-11-18)14-6-2-1-3-7-14/h8-9,12,14H,1-7,10-11H2,(H,20,21)/p-1 |
| InChIKey | DNXJPKHSMAJJRS-UHFFFAOYSA-M |
| XLogP | 3.23 |
| TPSA | 92.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|