C20H24NO5- — CID 170686481
4-nitro-3-[(8-propan-2-yl-8-tricyclo[5.2.1.02,6]decanyl)oxy]benzoate (PubChem CID 170686481) has the molecular formula C20H24NO5- and a molecular weight of 358.41 g/mol. Its IUPAC name is 4-nitro-3-[(8-propan-2-yl-8-tricyclo[5.2.1.02,6]decanyl)oxy]benzoate.
| Compound Name | 4-nitro-3-[(8-propan-2-yl-8-tricyclo[5.2.1.02,6]decanyl)oxy]benzoate |
|---|---|
| PubChem CID | 170686481 |
| Molecular Formula | C20H24NO5- |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | 4-nitro-3-[(8-propan-2-yl-8-tricyclo[5.2.1.02,6]decanyl)oxy]benzoate |
| SMILES | CC(C)C1(Oc2cc(C(=O)[O-])ccc2[N+](=O)[O-])CC2CC1C1CCCC21 |
| InChI | InChI=1S/C20H25NO5/c1-11(2)20(10-13-8-16(20)15-5-3-4-14(13)15)26-18-9-12(19(22)23)6-7-17(18)21(24)25/h6-7,9,11,13-16H,3-5,8,10H2,1-2H3,(H,22,23)/p-1 |
| InChIKey | XYRNOJFWDWMEED-UHFFFAOYSA-M |
| XLogP | 3.19 |
| TPSA | 92.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|