C18H23NO5 — CID 170686283
3-[(2-butan-2-yl-2-bicyclo[2.2.1]heptanyl)oxy]-4-nitrobenzoic acid (PubChem CID 170686283) has the molecular formula C18H23NO5 and a molecular weight of 333.38 g/mol. Its IUPAC name is 3-[(2-butan-2-yl-2-bicyclo[2.2.1]heptanyl)oxy]-4-nitrobenzoic acid.
| Compound Name | 3-[(2-butan-2-yl-2-bicyclo[2.2.1]heptanyl)oxy]-4-nitrobenzoic acid |
|---|---|
| PubChem CID | 170686283 |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 3-[(2-butan-2-yl-2-bicyclo[2.2.1]heptanyl)oxy]-4-nitrobenzoic acid |
| SMILES | CCC(C)C1(Oc2cc(C(=O)O)ccc2[N+](=O)[O-])CC2CCC1C2 |
| InChI | InChI=1S/C18H23NO5/c1-3-11(2)18(10-12-4-6-14(18)8-12)24-16-9-13(17(20)21)5-7-15(16)19(22)23/h5,7,9,11-12,14H,3-4,6,8,10H2,1-2H3,(H,20,21) |
| InChIKey | CGSCZKHSASSDTA-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|