C15H14F3O3- — CID 170686044
3-(1-ethenylcyclopentyl)oxy-4-(trifluoromethyl)benzoate (PubChem CID 170686044) has the molecular formula C15H14F3O3- and a molecular weight of 299.27 g/mol. Its IUPAC name is 3-(1-ethenylcyclopentyl)oxy-4-(trifluoromethyl)benzoate.
| Compound Name | 3-(1-ethenylcyclopentyl)oxy-4-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 170686044 |
| Molecular Formula | C15H14F3O3- |
| Molecular Weight | 299.27 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 3-(1-ethenylcyclopentyl)oxy-4-(trifluoromethyl)benzoate |
| SMILES | C=CC1(Oc2cc(C(=O)[O-])ccc2C(F)(F)F)CCCC1 |
| InChI | InChI=1S/C15H15F3O3/c1-2-14(7-3-4-8-14)21-12-9-10(13(19)20)5-6-11(12)15(16,17)18/h2,5-6,9H,1,3-4,7-8H2,(H,19,20)/p-1 |
| InChIKey | WCTRUUYGFWRRAM-UHFFFAOYSA-M |
| XLogP | 2.95 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.27 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|