C15H17F3O4 — CID 170686007
3-(1-cyclopentyloxyethoxy)-4-(trifluoromethyl)benzoic acid (PubChem CID 170686007) has the molecular formula C15H17F3O4 and a molecular weight of 318.29 g/mol. Its IUPAC name is 3-(1-cyclopentyloxyethoxy)-4-(trifluoromethyl)benzoic acid.
| Compound Name | 3-(1-cyclopentyloxyethoxy)-4-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 170686007 |
| Molecular Formula | C15H17F3O4 |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 3-(1-cyclopentyloxyethoxy)-4-(trifluoromethyl)benzoic acid |
| SMILES | CC(Oc1cc(C(=O)O)ccc1C(F)(F)F)OC1CCCC1 |
| InChI | InChI=1S/C15H17F3O4/c1-9(21-11-4-2-3-5-11)22-13-8-10(14(19)20)6-7-12(13)15(16,17)18/h6-9,11H,2-5H2,1H3,(H,19,20) |
| InChIKey | WTHXJEACWYEXLI-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|