C18H23F3O4 — CID 170686570
3-(1-cyclohexyloxy-2-methylpropoxy)-4-(trifluoromethyl)benzoic acid (PubChem CID 170686570) has the molecular formula C18H23F3O4 and a molecular weight of 360.37 g/mol. Its IUPAC name is 3-(1-cyclohexyloxy-2-methylpropoxy)-4-(trifluoromethyl)benzoic acid.
| Compound Name | 3-(1-cyclohexyloxy-2-methylpropoxy)-4-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 170686570 |
| Molecular Formula | C18H23F3O4 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 3-(1-cyclohexyloxy-2-methylpropoxy)-4-(trifluoromethyl)benzoic acid |
| SMILES | CC(C)C(Oc1cc(C(=O)O)ccc1C(F)(F)F)OC1CCCCC1 |
| InChI | InChI=1S/C18H23F3O4/c1-11(2)17(24-13-6-4-3-5-7-13)25-15-10-12(16(22)23)8-9-14(15)18(19,20)21/h8-11,13,17H,3-7H2,1-2H3,(H,22,23) |
| InChIKey | HEGLQXRXEYXAFS-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|