C23H28F3NO4S — CID 147044257
1-[4-(1-adamantylmethoxy)-3-(trifluoromethyl)phenyl]-2-(azetidin-1-ylsulfonyl)ethanone (PubChem CID 147044257) has the molecular formula C23H28F3NO4S and a molecular weight of 471.54 g/mol. Its IUPAC name is 1-[4-(1-adamantylmethoxy)-3-(trifluoromethyl)phenyl]-2-(azetidin-1-ylsulfonyl)ethanone.
| Compound Name | 1-[4-(1-adamantylmethoxy)-3-(trifluoromethyl)phenyl]-2-(azetidin-1-ylsulfonyl)ethanone |
|---|---|
| PubChem CID | 147044257 |
| Molecular Formula | C23H28F3NO4S |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | 1-[4-(1-adamantylmethoxy)-3-(trifluoromethyl)phenyl]-2-(azetidin-1-ylsulfonyl)ethanone |
| SMILES | O=C(CS(=O)(=O)N1CCC1)c1ccc(OCC23CC4CC(CC(C4)C2)C3)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H28F3NO4S/c24-23(25,26)19-9-18(20(28)13-32(29,30)27-4-1-5-27)2-3-21(19)31-14-22-10-15-6-16(11-22)8-17(7-15)12-22/h2-3,9,15-17H,1,4-8,10-14H2 |
| InChIKey | BABAYEABQWFJSD-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |