C24H31FO4S — CID 149376902
1-[4-(1-adamantylmethoxy)-5-cyclobutyl-2-fluorophenyl]-2-methylsulfonylethanone (PubChem CID 149376902) has the molecular formula C24H31FO4S and a molecular weight of 434.57 g/mol. Its IUPAC name is 1-[4-(1-adamantylmethoxy)-5-cyclobutyl-2-fluorophenyl]-2-methylsulfonylethanone.
| Compound Name | 1-[4-(1-adamantylmethoxy)-5-cyclobutyl-2-fluorophenyl]-2-methylsulfonylethanone |
|---|---|
| PubChem CID | 149376902 |
| Molecular Formula | C24H31FO4S |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | 1-[4-(1-adamantylmethoxy)-5-cyclobutyl-2-fluorophenyl]-2-methylsulfonylethanone |
| SMILES | CS(=O)(=O)CC(=O)c1cc(C2CCC2)c(OCC23CC4CC(CC(C4)C2)C3)cc1F |
| InChI | InChI=1S/C24H31FO4S/c1-30(27,28)13-22(26)20-8-19(18-3-2-4-18)23(9-21(20)25)29-14-24-10-15-5-16(11-24)7-17(6-15)12-24/h8-9,15-18H,2-7,10-14H2,1H3 |
| InChIKey | YKXDNAJZYFTRSK-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |