C23H31NO4S — CID 90015720
4-(1-adamantylmethoxy)-3-cyclobutyl-N-methylsulfonylbenzamide (PubChem CID 90015720) has the molecular formula C23H31NO4S and a molecular weight of 417.57 g/mol. Its IUPAC name is 4-(1-adamantylmethoxy)-3-cyclobutyl-N-methylsulfonylbenzamide.
| Compound Name | 4-(1-adamantylmethoxy)-3-cyclobutyl-N-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 90015720 |
| Molecular Formula | C23H31NO4S |
| Molecular Weight | 417.57 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | 4-(1-adamantylmethoxy)-3-cyclobutyl-N-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)NC(=O)c1ccc(OCC23CC4CC(CC(C4)C2)C3)c(C2CCC2)c1 |
| InChI | InChI=1S/C23H31NO4S/c1-29(26,27)24-22(25)19-5-6-21(20(10-19)18-3-2-4-18)28-14-23-11-15-7-16(12-23)9-17(8-15)13-23/h5-6,10,15-18H,2-4,7-9,11-14H2,1H3,(H,24,25) |
| InChIKey | NBYKHBQUUXDOJN-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.57 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |