C26H34FNO2 — CID 138699538
[4-(1-adamantylmethoxy)-5-cyclopropyl-2-fluorophenyl]-(3-methylpyrrolidin-1-yl)methanone (PubChem CID 138699538) has the molecular formula C26H34FNO2 and a molecular weight of 411.56 g/mol. Its IUPAC name is [4-(1-adamantylmethoxy)-5-cyclopropyl-2-fluorophenyl]-(3-methylpyrrolidin-1-yl)methanone.
| Compound Name | [4-(1-adamantylmethoxy)-5-cyclopropyl-2-fluorophenyl]-(3-methylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 138699538 |
| Molecular Formula | C26H34FNO2 |
| Molecular Weight | 411.56 g/mol |
| Exact Mass | 411.26 |
| IUPAC Name | [4-(1-adamantylmethoxy)-5-cyclopropyl-2-fluorophenyl]-(3-methylpyrrolidin-1-yl)methanone |
| SMILES | CC1CCN(C(=O)c2cc(C3CC3)c(OCC34CC5CC(CC(C5)C3)C4)cc2F)C1 |
| InChI | InChI=1S/C26H34FNO2/c1-16-4-5-28(14-16)25(29)22-9-21(20-2-3-20)24(10-23(22)27)30-15-26-11-17-6-18(12-26)8-19(7-17)13-26/h9-10,16-20H,2-8,11-15H2,1H3 |
| InChIKey | VCJJUQMVWWHHNH-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.56 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |