C27H34FNO2 — CID 138700159
[4-(1-adamantylmethoxy)-5-cyclopropyl-2-fluorophenyl]-[(3R)-3-ethenylpyrrolidin-1-yl]methanone (PubChem CID 138700159) has the molecular formula C27H34FNO2 and a molecular weight of 423.57 g/mol. Its IUPAC name is [4-(1-adamantylmethoxy)-5-cyclopropyl-2-fluorophenyl]-[(3R)-3-ethenylpyrrolidin-1-yl]methanone.
| Compound Name | [4-(1-adamantylmethoxy)-5-cyclopropyl-2-fluorophenyl]-[(3R)-3-ethenylpyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 138700159 |
| Molecular Formula | C27H34FNO2 |
| Molecular Weight | 423.57 g/mol |
| Exact Mass | 423.26 |
| IUPAC Name | [4-(1-adamantylmethoxy)-5-cyclopropyl-2-fluorophenyl]-[(3R)-3-ethenylpyrrolidin-1-yl]methanone |
| SMILES | C=C[C@H]1CCN(C(=O)c2cc(C3CC3)c(OCC34CC5CC(CC(C5)C3)C4)cc2F)C1 |
| InChI | InChI=1S/C27H34FNO2/c1-2-17-5-6-29(15-17)26(30)23-10-22(21-3-4-21)25(11-24(23)28)31-16-27-12-18-7-19(13-27)9-20(8-18)14-27/h2,10-11,17-21H,1,3-9,12-16H2/t17-,18?,19?,20?,27?/m0/s1 |
| InChIKey | SUDHOIVGCMCOGR-AWYKWWOESA-N |
| XLogP | 5.95 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.57 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|