C33H40FNO4 — CID 144996052
[4-(1-adamantylmethoxy)-5-cyclopropyl-2-fluorophenyl]-pyrrolidin-1-ylmethanone;benzyl formate (PubChem CID 144996052) has the molecular formula C33H40FNO4 and a molecular weight of 533.68 g/mol. Its IUPAC name is [4-(1-adamantylmethoxy)-5-cyclopropyl-2-fluorophenyl]-pyrrolidin-1-ylmethanone;benzyl formate.
| Compound Name | [4-(1-adamantylmethoxy)-5-cyclopropyl-2-fluorophenyl]-pyrrolidin-1-ylmethanone;benzyl formate |
|---|---|
| PubChem CID | 144996052 |
| Molecular Formula | C33H40FNO4 |
| Molecular Weight | 533.68 g/mol |
| Exact Mass | 533.29 |
| IUPAC Name | [4-(1-adamantylmethoxy)-5-cyclopropyl-2-fluorophenyl]-pyrrolidin-1-ylmethanone;benzyl formate |
| SMILES | O=C(c1cc(C2CC2)c(OCC23CC4CC(CC(C4)C2)C3)cc1F)N1CCCC1.O=COCc1ccccc1 |
| InChI | InChI=1S/C25H32FNO2.C8H8O2/c26-22-11-23(29-15-25-12-16-7-17(13-25)9-18(8-16)14-25)20(19-3-4-19)10-21(22)24(28)27-5-1-2-6-27;9-7-10-6-8-4-2-1-3-5-8/h10-11,16-19H,1-9,12-15H2;1-5,7H,6H2 |
| InChIKey | SAUJMTSAXMSSNK-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.68 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|