C18H20ClFO3 — CID 86702859
4-(1-adamantylmethoxy)-5-chloro-2-fluorobenzoic acid (PubChem CID 86702859) has the molecular formula C18H20ClFO3 and a molecular weight of 338.81 g/mol. Its IUPAC name is 4-(1-adamantylmethoxy)-5-chloro-2-fluorobenzoic acid.
| Compound Name | 4-(1-adamantylmethoxy)-5-chloro-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 86702859 |
| Molecular Formula | C18H20ClFO3 |
| Molecular Weight | 338.81 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | 4-(1-adamantylmethoxy)-5-chloro-2-fluorobenzoic acid |
| SMILES | O=C(O)c1cc(Cl)c(OCC23CC4CC(CC(C4)C2)C3)cc1F |
| InChI | InChI=1S/C18H20ClFO3/c19-14-4-13(17(21)22)15(20)5-16(14)23-9-18-6-10-1-11(7-18)3-12(2-10)8-18/h4-5,10-12H,1-3,6-9H2,(H,21,22) |
| InChIKey | LZITVESSRMXAPM-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.81 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |