C21H27FO2 — CID 123713237
1-[4-(1-adamantylmethoxy)-5-ethyl-2-fluorophenyl]ethanone (PubChem CID 123713237) has the molecular formula C21H27FO2 and a molecular weight of 330.44 g/mol. Its IUPAC name is 1-[4-(1-adamantylmethoxy)-5-ethyl-2-fluorophenyl]ethanone.
| Compound Name | 1-[4-(1-adamantylmethoxy)-5-ethyl-2-fluorophenyl]ethanone |
|---|---|
| PubChem CID | 123713237 |
| Molecular Formula | C21H27FO2 |
| Molecular Weight | 330.44 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | 1-[4-(1-adamantylmethoxy)-5-ethyl-2-fluorophenyl]ethanone |
| SMILES | CCc1cc(C(C)=O)c(F)cc1OCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H27FO2/c1-3-17-7-18(13(2)23)19(22)8-20(17)24-12-21-9-14-4-15(10-21)6-16(5-14)11-21/h7-8,14-16H,3-6,9-12H2,1-2H3 |
| InChIKey | DEHZWTKDRQDSMV-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.44 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |