C19H21Cl2FO2 — CID 123816292
1-[5-chloro-4-[(3-chloro-1-adamantyl)methoxy]-2-fluorophenyl]ethanone (PubChem CID 123816292) has the molecular formula C19H21Cl2FO2 and a molecular weight of 371.28 g/mol. Its IUPAC name is 1-[5-chloro-4-[(3-chloro-1-adamantyl)methoxy]-2-fluorophenyl]ethanone.
| Compound Name | 1-[5-chloro-4-[(3-chloro-1-adamantyl)methoxy]-2-fluorophenyl]ethanone |
|---|---|
| PubChem CID | 123816292 |
| Molecular Formula | C19H21Cl2FO2 |
| Molecular Weight | 371.28 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | 1-[5-chloro-4-[(3-chloro-1-adamantyl)methoxy]-2-fluorophenyl]ethanone |
| SMILES | CC(=O)c1cc(Cl)c(OCC23CC4CC(CC(Cl)(C4)C2)C3)cc1F |
| InChI | InChI=1S/C19H21Cl2FO2/c1-11(23)14-3-15(20)17(4-16(14)22)24-10-18-5-12-2-13(6-18)8-19(21,7-12)9-18/h3-4,12-13H,2,5-10H2,1H3 |
| InChIKey | FGAVVBNWORDWHR-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.28 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|