C22H28ClFO3S — CID 166761434
1-[(2-chloro-4-cyclopentylsulfonyl-5-fluorophenoxy)methyl]adamantane (PubChem CID 166761434) has the molecular formula C22H28ClFO3S and a molecular weight of 426.98 g/mol. Its IUPAC name is 1-[(2-chloro-4-cyclopentylsulfonyl-5-fluorophenoxy)methyl]adamantane.
| Compound Name | 1-[(2-chloro-4-cyclopentylsulfonyl-5-fluorophenoxy)methyl]adamantane |
|---|---|
| PubChem CID | 166761434 |
| Molecular Formula | C22H28ClFO3S |
| Molecular Weight | 426.98 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | 1-[(2-chloro-4-cyclopentylsulfonyl-5-fluorophenoxy)methyl]adamantane |
| SMILES | O=S(=O)(c1cc(Cl)c(OCC23CC4CC(CC(C4)C2)C3)cc1F)C1CCCC1 |
| InChI | InChI=1S/C22H28ClFO3S/c23-18-8-21(28(25,26)17-3-1-2-4-17)19(24)9-20(18)27-13-22-10-14-5-15(11-22)7-16(6-14)12-22/h8-9,14-17H,1-7,10-13H2 |
| InChIKey | BBWLXGVHENWIFF-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.98 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |