C22H28FIO3 — CID 86703626
tert-butyl 4-(1-adamantylmethoxy)-2-fluoro-5-iodobenzoate (PubChem CID 86703626) has the molecular formula C22H28FIO3 and a molecular weight of 486.37 g/mol. Its IUPAC name is tert-butyl 4-(1-adamantylmethoxy)-2-fluoro-5-iodobenzoate.
| Compound Name | tert-butyl 4-(1-adamantylmethoxy)-2-fluoro-5-iodobenzoate |
|---|---|
| PubChem CID | 86703626 |
| Molecular Formula | C22H28FIO3 |
| Molecular Weight | 486.37 g/mol |
| Exact Mass | 486.11 |
| IUPAC Name | tert-butyl 4-(1-adamantylmethoxy)-2-fluoro-5-iodobenzoate |
| SMILES | CC(C)(C)OC(=O)c1cc(I)c(OCC23CC4CC(CC(C4)C2)C3)cc1F |
| InChI | InChI=1S/C22H28FIO3/c1-21(2,3)27-20(25)16-7-18(24)19(8-17(16)23)26-12-22-9-13-4-14(10-22)6-15(5-13)11-22/h7-8,13-15H,4-6,9-12H2,1-3H3 |
| InChIKey | WGHIBRGWTGWVHD-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.37 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|