C19H26FNO3 — CID 118353600
tert-butyl 5-cyclopropyl-2-fluoro-4-[(3-methylazetidin-3-yl)methoxy]benzoate (PubChem CID 118353600) has the molecular formula C19H26FNO3 and a molecular weight of 335.42 g/mol. Its IUPAC name is tert-butyl 5-cyclopropyl-2-fluoro-4-[(3-methylazetidin-3-yl)methoxy]benzoate.
| Compound Name | tert-butyl 5-cyclopropyl-2-fluoro-4-[(3-methylazetidin-3-yl)methoxy]benzoate |
|---|---|
| PubChem CID | 118353600 |
| Molecular Formula | C19H26FNO3 |
| Molecular Weight | 335.42 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | tert-butyl 5-cyclopropyl-2-fluoro-4-[(3-methylazetidin-3-yl)methoxy]benzoate |
| SMILES | CC1(COc2cc(F)c(C(=O)OC(C)(C)C)cc2C2CC2)CNC1 |
| InChI | InChI=1S/C19H26FNO3/c1-18(2,3)24-17(22)14-7-13(12-5-6-12)16(8-15(14)20)23-11-19(4)9-21-10-19/h7-8,12,21H,5-6,9-11H2,1-4H3 |
| InChIKey | QDLGSINGFOAXGH-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.42 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |