C31H34FNO3 — CID 86703779
tert-butyl 4-[(1-benzhydrylazetidin-3-yl)methoxy]-5-cyclopropyl-2-fluorobenzoate (PubChem CID 86703779) has the molecular formula C31H34FNO3 and a molecular weight of 487.62 g/mol. Its IUPAC name is tert-butyl 4-[(1-benzhydrylazetidin-3-yl)methoxy]-5-cyclopropyl-2-fluorobenzoate.
| Compound Name | tert-butyl 4-[(1-benzhydrylazetidin-3-yl)methoxy]-5-cyclopropyl-2-fluorobenzoate |
|---|---|
| PubChem CID | 86703779 |
| Molecular Formula | C31H34FNO3 |
| Molecular Weight | 487.62 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | tert-butyl 4-[(1-benzhydrylazetidin-3-yl)methoxy]-5-cyclopropyl-2-fluorobenzoate |
| SMILES | CC(C)(C)OC(=O)c1cc(C2CC2)c(OCC2CN(C(c3ccccc3)c3ccccc3)C2)cc1F |
| InChI | InChI=1S/C31H34FNO3/c1-31(2,3)36-30(34)26-16-25(22-14-15-22)28(17-27(26)32)35-20-21-18-33(19-21)29(23-10-6-4-7-11-23)24-12-8-5-9-13-24/h4-13,16-17,21-22,29H,14-15,18-20H2,1-3H3 |
| InChIKey | WIFDYUJWJSXECH-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.62 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |