C30H30F4N2O2S — CID 144850807
4-[(1-benzhydrylazetidin-3-yl)methoxy]-5-cyclopropyl-2-fluoro-N-(3,3,3-trifluoropropylsulfanyl)benzamide (PubChem CID 144850807) has the molecular formula C30H30F4N2O2S and a molecular weight of 558.64 g/mol. Its IUPAC name is 4-[(1-benzhydrylazetidin-3-yl)methoxy]-5-cyclopropyl-2-fluoro-N-(3,3,3-trifluoropropylsulfanyl)benzamide.
| Compound Name | 4-[(1-benzhydrylazetidin-3-yl)methoxy]-5-cyclopropyl-2-fluoro-N-(3,3,3-trifluoropropylsulfanyl)benzamide |
|---|---|
| PubChem CID | 144850807 |
| Molecular Formula | C30H30F4N2O2S |
| Molecular Weight | 558.64 g/mol |
| Exact Mass | 558.20 |
| IUPAC Name | 4-[(1-benzhydrylazetidin-3-yl)methoxy]-5-cyclopropyl-2-fluoro-N-(3,3,3-trifluoropropylsulfanyl)benzamide |
| SMILES | O=C(NSCCC(F)(F)F)c1cc(C2CC2)c(OCC2CN(C(c3ccccc3)c3ccccc3)C2)cc1F |
| InChI | InChI=1S/C30H30F4N2O2S/c31-26-16-27(24(21-11-12-21)15-25(26)29(37)35-39-14-13-30(32,33)34)38-19-20-17-36(18-20)28(22-7-3-1-4-8-22)23-9-5-2-6-10-23/h1-10,15-16,20-21,28H,11-14,17-19H2,(H,35,37) |
| InChIKey | AQHZRZKAGNYCIV-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.64 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|