C29H31FN2O4S — CID 86703781
4-[(1-benzhydrylazetidin-3-yl)methoxy]-5-cyclopropyl-N-ethylsulfonyl-2-fluorobenzamide (PubChem CID 86703781) has the molecular formula C29H31FN2O4S and a molecular weight of 522.64 g/mol. Its IUPAC name is 4-[(1-benzhydrylazetidin-3-yl)methoxy]-5-cyclopropyl-N-ethylsulfonyl-2-fluorobenzamide.
| Compound Name | 4-[(1-benzhydrylazetidin-3-yl)methoxy]-5-cyclopropyl-N-ethylsulfonyl-2-fluorobenzamide |
|---|---|
| PubChem CID | 86703781 |
| Molecular Formula | C29H31FN2O4S |
| Molecular Weight | 522.64 g/mol |
| Exact Mass | 522.20 |
| IUPAC Name | 4-[(1-benzhydrylazetidin-3-yl)methoxy]-5-cyclopropyl-N-ethylsulfonyl-2-fluorobenzamide |
| SMILES | CCS(=O)(=O)NC(=O)c1cc(C2CC2)c(OCC2CN(C(c3ccccc3)c3ccccc3)C2)cc1F |
| InChI | InChI=1S/C29H31FN2O4S/c1-2-37(34,35)31-29(33)25-15-24(21-13-14-21)27(16-26(25)30)36-19-20-17-32(18-20)28(22-9-5-3-6-10-22)23-11-7-4-8-12-23/h3-12,15-16,20-21,28H,2,13-14,17-19H2,1H3,(H,31,33) |
| InChIKey | ZYXFMORUSXACMR-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.64 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |