About tert-butyl 5-cyclopropyl-4-[(3R)-5,5-dimethylpiperidin-3-yl]oxy-2-fluorobenzoate
tert-butyl 5-cyclopropyl-4-[(3R)-5,5-dimethylpiperidin-3-yl]oxy-2-fluorobenzoate (PubChem CID 118110489) has the molecular formula C21H30FNO3
and a molecular weight of 363.47 g/mol. Its IUPAC name is tert-butyl 5-cyclopropyl-4-[(3R)-5,5-dimethylpiperidin-3-yl]oxy-2-fluorobenzoate.
Molecular Properties
| Compound Name | tert-butyl 5-cyclopropyl-4-[(3R)-5,5-dimethylpiperidin-3-yl]oxy-2-fluorobenzoate |
| PubChem CID | 118110489 |
| Molecular Formula | C21H30FNO3 |
| Molecular Weight | 363.47 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | tert-butyl 5-cyclopropyl-4-[(3R)-5,5-dimethylpiperidin-3-yl]oxy-2-fluorobenzoate |
| SMILES | CC1(C)CNC[C@H](Oc2cc(F)c(C(=O)OC(C)(C)C)cc2C2CC2)C1 |
| InChI | InChI=1S/C21H30FNO3/c1-20(2,3)26-19(24)16-8-15(13-6-7-13)18(9-17(16)22)25-14-10-21(4,5)12-23-11-14/h8-9,13-14,23H,6-7,10-12H2,1-5H3/t14-/m1/s1 |
| InChIKey | KBINDUHBIOQFCR-CQSZACIVSA-N |
| XLogP | 4.43 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.47 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl 5-cyclopropyl-4-[(3R)-5,5-dimethylpiperidin-3-yl]oxy-2-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 5-cyclopropyl-4-[(3R)-5,5-dimethylpiperidin-3-yl]oxy-2-fluorobenzoate?
The IUPAC name of tert-butyl 5-cyclopropyl-4-[(3R)-5,5-dimethylpiperidin-3-yl]oxy-2-fluorobenzoate (CID 118110489) is tert-butyl 5-cyclopropyl-4-[(3R)-5,5-dimethylpiperidin-3-yl]oxy-2-fluorobenzoate.
What is the SMILES notation for tert-butyl 5-cyclopropyl-4-[(3R)-5,5-dimethylpiperidin-3-yl]oxy-2-fluorobenzoate?
The canonical SMILES for tert-butyl 5-cyclopropyl-4-[(3R)-5,5-dimethylpiperidin-3-yl]oxy-2-fluorobenzoate is CC1(C)CNC[C@H](Oc2cc(F)c(C(=O)OC(C)(C)C)cc2C2CC2)C1.
What is the InChIKey of tert-butyl 5-cyclopropyl-4-[(3R)-5,5-dimethylpiperidin-3-yl]oxy-2-fluorobenzoate?
The InChIKey is KBINDUHBIOQFCR-CQSZACIVSA-N. The full InChI is InChI=1S/C21H30FNO3/c1-20(2,3)26-19(24)16-8-15(13-6-7-13)18(9-17(16)22)25-14-10-21(4,5)12-23-11-14/h8-9,13-14,23H,6-7,10-12H2,1-5H3/t14-/m1/s1.
What are the key properties of tert-butyl 5-cyclopropyl-4-[(3R)-5,5-dimethylpiperidin-3-yl]oxy-2-fluorobenzoate?
tert-butyl 5-cyclopropyl-4-[(3R)-5,5-dimethylpiperidin-3-yl]oxy-2-fluorobenzoate has a molecular weight of 363.47 g/mol, XLogP of 4.43, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 5-cyclopropyl-4-[(3R)-5,5-dimethylpiperidin-3-yl]oxy-2-fluorobenzoate is sourced from PubChem (CID 118110489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).