C17H23ClFNO3 — CID 174800043
tert-butyl 5-chloro-2-fluoro-4-(piperidin-3-ylmethoxy)benzoate (PubChem CID 174800043) has the molecular formula C17H23ClFNO3 and a molecular weight of 343.83 g/mol. Its IUPAC name is tert-butyl 5-chloro-2-fluoro-4-(piperidin-3-ylmethoxy)benzoate.
| Compound Name | tert-butyl 5-chloro-2-fluoro-4-(piperidin-3-ylmethoxy)benzoate |
|---|---|
| PubChem CID | 174800043 |
| Molecular Formula | C17H23ClFNO3 |
| Molecular Weight | 343.83 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | tert-butyl 5-chloro-2-fluoro-4-(piperidin-3-ylmethoxy)benzoate |
| SMILES | CC(C)(C)OC(=O)c1cc(Cl)c(OCC2CCCNC2)cc1F |
| InChI | InChI=1S/C17H23ClFNO3/c1-17(2,3)23-16(21)12-7-13(18)15(8-14(12)19)22-10-11-5-4-6-20-9-11/h7-8,11,20H,4-6,9-10H2,1-3H3 |
| InChIKey | GAKYLOZPXKYAJB-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.83 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |