C24H29ClFNO3 — CID 118110654
tert-butyl 4-[(1-benzylpiperidin-4-yl)methoxy]-5-chloro-2-fluorobenzoate (PubChem CID 118110654) has the molecular formula C24H29ClFNO3 and a molecular weight of 433.95 g/mol. Its IUPAC name is tert-butyl 4-[(1-benzylpiperidin-4-yl)methoxy]-5-chloro-2-fluorobenzoate.
| Compound Name | tert-butyl 4-[(1-benzylpiperidin-4-yl)methoxy]-5-chloro-2-fluorobenzoate |
|---|---|
| PubChem CID | 118110654 |
| Molecular Formula | C24H29ClFNO3 |
| Molecular Weight | 433.95 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | tert-butyl 4-[(1-benzylpiperidin-4-yl)methoxy]-5-chloro-2-fluorobenzoate |
| SMILES | CC(C)(C)OC(=O)c1cc(Cl)c(OCC2CCN(Cc3ccccc3)CC2)cc1F |
| InChI | InChI=1S/C24H29ClFNO3/c1-24(2,3)30-23(28)19-13-20(25)22(14-21(19)26)29-16-18-9-11-27(12-10-18)15-17-7-5-4-6-8-17/h4-8,13-14,18H,9-12,15-16H2,1-3H3 |
| InChIKey | ZPDZSBNULCNRFE-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.95 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |