C26H32FNO3 — CID 118120671
tert-butyl 4-[(3R)-1-benzylpiperidin-3-yl]oxy-5-cyclopropyl-2-fluorobenzoate (PubChem CID 118120671) has the molecular formula C26H32FNO3 and a molecular weight of 425.54 g/mol. Its IUPAC name is tert-butyl 4-[(3R)-1-benzylpiperidin-3-yl]oxy-5-cyclopropyl-2-fluorobenzoate.
| Compound Name | tert-butyl 4-[(3R)-1-benzylpiperidin-3-yl]oxy-5-cyclopropyl-2-fluorobenzoate |
|---|---|
| PubChem CID | 118120671 |
| Molecular Formula | C26H32FNO3 |
| Molecular Weight | 425.54 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | tert-butyl 4-[(3R)-1-benzylpiperidin-3-yl]oxy-5-cyclopropyl-2-fluorobenzoate |
| SMILES | CC(C)(C)OC(=O)c1cc(C2CC2)c(O[C@@H]2CCCN(Cc3ccccc3)C2)cc1F |
| InChI | InChI=1S/C26H32FNO3/c1-26(2,3)31-25(29)22-14-21(19-11-12-19)24(15-23(22)27)30-20-10-7-13-28(17-20)16-18-8-5-4-6-9-18/h4-6,8-9,14-15,19-20H,7,10-13,16-17H2,1-3H3/t20-/m1/s1 |
| InChIKey | YTFDMRKZBWFHQW-HXUWFJFHSA-N |
| XLogP | 5.70 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.54 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |