C26H31FN2O2S — CID 144849852
5-cyclopropyl-N-cyclopropylsulfanyl-2-fluoro-4-[1-[(4-methylphenyl)methyl]piperidin-3-yl]oxybenzamide (PubChem CID 144849852) has the molecular formula C26H31FN2O2S and a molecular weight of 454.61 g/mol. Its IUPAC name is 5-cyclopropyl-N-cyclopropylsulfanyl-2-fluoro-4-[1-[(4-methylphenyl)methyl]piperidin-3-yl]oxybenzamide.
| Compound Name | 5-cyclopropyl-N-cyclopropylsulfanyl-2-fluoro-4-[1-[(4-methylphenyl)methyl]piperidin-3-yl]oxybenzamide |
|---|---|
| PubChem CID | 144849852 |
| Molecular Formula | C26H31FN2O2S |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | 5-cyclopropyl-N-cyclopropylsulfanyl-2-fluoro-4-[1-[(4-methylphenyl)methyl]piperidin-3-yl]oxybenzamide |
| SMILES | Cc1ccc(CN2CCCC(Oc3cc(F)c(C(=O)NSC4CC4)cc3C3CC3)C2)cc1 |
| InChI | InChI=1S/C26H31FN2O2S/c1-17-4-6-18(7-5-17)15-29-12-2-3-20(16-29)31-25-14-24(27)23(13-22(25)19-8-9-19)26(30)28-32-21-10-11-21/h4-7,13-14,19-21H,2-3,8-12,15-16H2,1H3,(H,28,30) |
| InChIKey | WLZSYNZLZLVUSV-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|