C31H33FN2O2S — CID 144850062
4-(1-benzhydrylpiperidin-3-yl)oxy-5-cyclopropyl-N-cyclopropylsulfanyl-2-fluorobenzamide (PubChem CID 144850062) has the molecular formula C31H33FN2O2S and a molecular weight of 516.68 g/mol. Its IUPAC name is 4-(1-benzhydrylpiperidin-3-yl)oxy-5-cyclopropyl-N-cyclopropylsulfanyl-2-fluorobenzamide.
| Compound Name | 4-(1-benzhydrylpiperidin-3-yl)oxy-5-cyclopropyl-N-cyclopropylsulfanyl-2-fluorobenzamide |
|---|---|
| PubChem CID | 144850062 |
| Molecular Formula | C31H33FN2O2S |
| Molecular Weight | 516.68 g/mol |
| Exact Mass | 516.22 |
| IUPAC Name | 4-(1-benzhydrylpiperidin-3-yl)oxy-5-cyclopropyl-N-cyclopropylsulfanyl-2-fluorobenzamide |
| SMILES | O=C(NSC1CC1)c1cc(C2CC2)c(OC2CCCN(C(c3ccccc3)c3ccccc3)C2)cc1F |
| InChI | InChI=1S/C31H33FN2O2S/c32-28-19-29(26(21-13-14-21)18-27(28)31(35)33-37-25-15-16-25)36-24-12-7-17-34(20-24)30(22-8-3-1-4-9-22)23-10-5-2-6-11-23/h1-6,8-11,18-19,21,24-25,30H,7,12-17,20H2,(H,33,35) |
| InChIKey | PYKXTARHWJINKR-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.68 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|