C25H27Cl2FN2O2S — CID 144849875
5-cyclopropyl-N-cyclopropylsulfanyl-4-[(3R)-1-[(2,4-dichlorophenyl)methyl]piperidin-3-yl]oxy-2-fluorobenzamide (PubChem CID 144849875) has the molecular formula C25H27Cl2FN2O2S and a molecular weight of 509.47 g/mol. Its IUPAC name is 5-cyclopropyl-N-cyclopropylsulfanyl-4-[(3R)-1-[(2,4-dichlorophenyl)methyl]piperidin-3-yl]oxy-2-fluorobenzamide.
| Compound Name | 5-cyclopropyl-N-cyclopropylsulfanyl-4-[(3R)-1-[(2,4-dichlorophenyl)methyl]piperidin-3-yl]oxy-2-fluorobenzamide |
|---|---|
| PubChem CID | 144849875 |
| Molecular Formula | C25H27Cl2FN2O2S |
| Molecular Weight | 509.47 g/mol |
| Exact Mass | 508.12 |
| IUPAC Name | 5-cyclopropyl-N-cyclopropylsulfanyl-4-[(3R)-1-[(2,4-dichlorophenyl)methyl]piperidin-3-yl]oxy-2-fluorobenzamide |
| SMILES | O=C(NSC1CC1)c1cc(C2CC2)c(O[C@@H]2CCCN(Cc3ccc(Cl)cc3Cl)C2)cc1F |
| InChI | InChI=1S/C25H27Cl2FN2O2S/c26-17-6-5-16(22(27)10-17)13-30-9-1-2-18(14-30)32-24-12-23(28)21(11-20(24)15-3-4-15)25(31)29-33-19-7-8-19/h5-6,10-12,15,18-19H,1-4,7-9,13-14H2,(H,29,31)/t18-/m1/s1 |
| InChIKey | GUHBXITZVUXVEA-GOSISDBHSA-N |
| XLogP | 6.59 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.47 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|