C25H29ClFN3O2S — CID 144849866
N-(azetidin-1-ylsulfanyl)-4-[(3R)-1-[(2-chlorophenyl)methyl]piperidin-3-yl]oxy-5-cyclopropyl-2-fluorobenzamide (PubChem CID 144849866) has the molecular formula C25H29ClFN3O2S and a molecular weight of 490.04 g/mol. Its IUPAC name is N-(azetidin-1-ylsulfanyl)-4-[(3R)-1-[(2-chlorophenyl)methyl]piperidin-3-yl]oxy-5-cyclopropyl-2-fluorobenzamide.
| Compound Name | N-(azetidin-1-ylsulfanyl)-4-[(3R)-1-[(2-chlorophenyl)methyl]piperidin-3-yl]oxy-5-cyclopropyl-2-fluorobenzamide |
|---|---|
| PubChem CID | 144849866 |
| Molecular Formula | C25H29ClFN3O2S |
| Molecular Weight | 490.04 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | N-(azetidin-1-ylsulfanyl)-4-[(3R)-1-[(2-chlorophenyl)methyl]piperidin-3-yl]oxy-5-cyclopropyl-2-fluorobenzamide |
| SMILES | O=C(NSN1CCC1)c1cc(C2CC2)c(O[C@@H]2CCCN(Cc3ccccc3Cl)C2)cc1F |
| InChI | InChI=1S/C25H29ClFN3O2S/c26-22-7-2-1-5-18(22)15-29-10-3-6-19(16-29)32-24-14-23(27)21(13-20(24)17-8-9-17)25(31)28-33-30-11-4-12-30/h1-2,5,7,13-14,17,19H,3-4,6,8-12,15-16H2,(H,28,31)/t19-/m1/s1 |
| InChIKey | GMIZMVDWIOHALK-LJQANCHMSA-N |
| XLogP | 5.40 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.04 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|