C19H26FN3OS — CID 144850051
N-(azetidin-1-ylsulfanyl)-5-cyclopropyl-2-fluoro-4-(piperidin-1-ylmethyl)benzamide (PubChem CID 144850051) has the molecular formula C19H26FN3OS and a molecular weight of 363.50 g/mol. Its IUPAC name is N-(azetidin-1-ylsulfanyl)-5-cyclopropyl-2-fluoro-4-(piperidin-1-ylmethyl)benzamide.
| Compound Name | N-(azetidin-1-ylsulfanyl)-5-cyclopropyl-2-fluoro-4-(piperidin-1-ylmethyl)benzamide |
|---|---|
| PubChem CID | 144850051 |
| Molecular Formula | C19H26FN3OS |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | N-(azetidin-1-ylsulfanyl)-5-cyclopropyl-2-fluoro-4-(piperidin-1-ylmethyl)benzamide |
| SMILES | O=C(NSN1CCC1)c1cc(C2CC2)c(CN2CCCCC2)cc1F |
| InChI | InChI=1S/C19H26FN3OS/c20-18-11-15(13-22-7-2-1-3-8-22)16(14-5-6-14)12-17(18)19(24)21-25-23-9-4-10-23/h11-12,14H,1-10,13H2,(H,21,24) |
| InChIKey | WQSTVEHSKLHHPJ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|