C22H23ClFNO3 — CID 118110819
4-[(3R)-1-[(2-chlorophenyl)methyl]piperidin-3-yl]oxy-5-cyclopropyl-2-fluorobenzoic acid (PubChem CID 118110819) has the molecular formula C22H23ClFNO3 and a molecular weight of 403.88 g/mol. Its IUPAC name is 4-[(3R)-1-[(2-chlorophenyl)methyl]piperidin-3-yl]oxy-5-cyclopropyl-2-fluorobenzoic acid.
| Compound Name | 4-[(3R)-1-[(2-chlorophenyl)methyl]piperidin-3-yl]oxy-5-cyclopropyl-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 118110819 |
| Molecular Formula | C22H23ClFNO3 |
| Molecular Weight | 403.88 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | 4-[(3R)-1-[(2-chlorophenyl)methyl]piperidin-3-yl]oxy-5-cyclopropyl-2-fluorobenzoic acid |
| SMILES | O=C(O)c1cc(C2CC2)c(O[C@@H]2CCCN(Cc3ccccc3Cl)C2)cc1F |
| InChI | InChI=1S/C22H23ClFNO3/c23-19-6-2-1-4-15(19)12-25-9-3-5-16(13-25)28-21-11-20(24)18(22(26)27)10-17(21)14-7-8-14/h1-2,4,6,10-11,14,16H,3,5,7-9,12-13H2,(H,26,27)/t16-/m1/s1 |
| InChIKey | IAFIUSQFFOHFTN-MRXNPFEDSA-N |
| XLogP | 5.10 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.88 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |