C23H26FNO3 — CID 118353520
5-cyclopropyl-2-fluoro-4-[1-[(4-methylphenyl)methyl]piperidin-3-yl]oxybenzoic acid (PubChem CID 118353520) has the molecular formula C23H26FNO3 and a molecular weight of 383.46 g/mol. Its IUPAC name is 5-cyclopropyl-2-fluoro-4-[1-[(4-methylphenyl)methyl]piperidin-3-yl]oxybenzoic acid.
| Compound Name | 5-cyclopropyl-2-fluoro-4-[1-[(4-methylphenyl)methyl]piperidin-3-yl]oxybenzoic acid |
|---|---|
| PubChem CID | 118353520 |
| Molecular Formula | C23H26FNO3 |
| Molecular Weight | 383.46 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | 5-cyclopropyl-2-fluoro-4-[1-[(4-methylphenyl)methyl]piperidin-3-yl]oxybenzoic acid |
| SMILES | Cc1ccc(CN2CCCC(Oc3cc(F)c(C(=O)O)cc3C3CC3)C2)cc1 |
| InChI | InChI=1S/C23H26FNO3/c1-15-4-6-16(7-5-15)13-25-10-2-3-18(14-25)28-22-12-21(24)20(23(26)27)11-19(22)17-8-9-17/h4-7,11-12,17-18H,2-3,8-10,13-14H2,1H3,(H,26,27) |
| InChIKey | NGYMOOIQFLHSKK-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.46 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |