C24H29FN4O3S — CID 144849883
N'-(azetidin-1-ylsulfanyl)-4-(1-benzylpyrrolidin-3-yl)oxy-5-cyclopropyl-2-fluoro-N'-hydroxybenzohydrazide (PubChem CID 144849883) has the molecular formula C24H29FN4O3S and a molecular weight of 472.59 g/mol. Its IUPAC name is N'-(azetidin-1-ylsulfanyl)-4-(1-benzylpyrrolidin-3-yl)oxy-5-cyclopropyl-2-fluoro-N'-hydroxybenzohydrazide.
| Compound Name | N'-(azetidin-1-ylsulfanyl)-4-(1-benzylpyrrolidin-3-yl)oxy-5-cyclopropyl-2-fluoro-N'-hydroxybenzohydrazide |
|---|---|
| PubChem CID | 144849883 |
| Molecular Formula | C24H29FN4O3S |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | N'-(azetidin-1-ylsulfanyl)-4-(1-benzylpyrrolidin-3-yl)oxy-5-cyclopropyl-2-fluoro-N'-hydroxybenzohydrazide |
| SMILES | O=C(NN(O)SN1CCC1)c1cc(C2CC2)c(OC2CCN(Cc3ccccc3)C2)cc1F |
| InChI | InChI=1S/C24H29FN4O3S/c25-22-14-23(32-19-9-12-27(16-19)15-17-5-2-1-3-6-17)20(18-7-8-18)13-21(22)24(30)26-29(31)33-28-10-4-11-28/h1-3,5-6,13-14,18-19,31H,4,7-12,15-16H2,(H,26,30) |
| InChIKey | WTSBRLDLMDTPES-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 68.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|