C27H35FN2O4S — CID 144850616
5-cyclopropyl-4-[1-[(2,4-diethoxyphenyl)methyl]piperidin-3-yl]oxy-2-fluoro-N-methylsulfanylbenzamide (PubChem CID 144850616) has the molecular formula C27H35FN2O4S and a molecular weight of 502.65 g/mol. Its IUPAC name is 5-cyclopropyl-4-[1-[(2,4-diethoxyphenyl)methyl]piperidin-3-yl]oxy-2-fluoro-N-methylsulfanylbenzamide.
| Compound Name | 5-cyclopropyl-4-[1-[(2,4-diethoxyphenyl)methyl]piperidin-3-yl]oxy-2-fluoro-N-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 144850616 |
| Molecular Formula | C27H35FN2O4S |
| Molecular Weight | 502.65 g/mol |
| Exact Mass | 502.23 |
| IUPAC Name | 5-cyclopropyl-4-[1-[(2,4-diethoxyphenyl)methyl]piperidin-3-yl]oxy-2-fluoro-N-methylsulfanylbenzamide |
| SMILES | CCOc1ccc(CN2CCCC(Oc3cc(F)c(C(=O)NSC)cc3C3CC3)C2)c(OCC)c1 |
| InChI | InChI=1S/C27H35FN2O4S/c1-4-32-20-11-10-19(25(13-20)33-5-2)16-30-12-6-7-21(17-30)34-26-15-24(28)23(27(31)29-35-3)14-22(26)18-8-9-18/h10-11,13-15,18,21H,4-9,12,16-17H2,1-3H3,(H,29,31) |
| InChIKey | NVMNUGDTYPLBBY-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.65 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|