C25H28F4N2O2S — CID 144849863
5-cyclopropyl-2-fluoro-N-methylsulfanyl-4-[[1-[[2-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]methoxy]benzamide (PubChem CID 144849863) has the molecular formula C25H28F4N2O2S and a molecular weight of 496.57 g/mol. Its IUPAC name is 5-cyclopropyl-2-fluoro-N-methylsulfanyl-4-[[1-[[2-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]methoxy]benzamide.
| Compound Name | 5-cyclopropyl-2-fluoro-N-methylsulfanyl-4-[[1-[[2-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]methoxy]benzamide |
|---|---|
| PubChem CID | 144849863 |
| Molecular Formula | C25H28F4N2O2S |
| Molecular Weight | 496.57 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | 5-cyclopropyl-2-fluoro-N-methylsulfanyl-4-[[1-[[2-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]methoxy]benzamide |
| SMILES | CSNC(=O)c1cc(C2CC2)c(OCC2CCN(Cc3ccccc3C(F)(F)F)CC2)cc1F |
| InChI | InChI=1S/C25H28F4N2O2S/c1-34-30-24(32)20-12-19(17-6-7-17)23(13-22(20)26)33-15-16-8-10-31(11-9-16)14-18-4-2-3-5-21(18)25(27,28)29/h2-5,12-13,16-17H,6-11,14-15H2,1H3,(H,30,32) |
| InChIKey | YAZSXEKPFCBDLD-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.57 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|