C30H43Cl2FN2O3S — CID 144850656
5-cyclopropyl-4-[[1-[1-(2,4-dichlorophenyl)-2-methoxyethyl]piperidin-4-yl]methoxy]-2-fluoro-N-methylsulfanylbenzamide;ethane (PubChem CID 144850656) has the molecular formula C30H43Cl2FN2O3S and a molecular weight of 601.66 g/mol. Its IUPAC name is 5-cyclopropyl-4-[[1-[1-(2,4-dichlorophenyl)-2-methoxyethyl]piperidin-4-yl]methoxy]-2-fluoro-N-methylsulfanylbenzamide;ethane.
| Compound Name | 5-cyclopropyl-4-[[1-[1-(2,4-dichlorophenyl)-2-methoxyethyl]piperidin-4-yl]methoxy]-2-fluoro-N-methylsulfanylbenzamide;ethane |
|---|---|
| PubChem CID | 144850656 |
| Molecular Formula | C30H43Cl2FN2O3S |
| Molecular Weight | 601.66 g/mol |
| Exact Mass | 600.24 |
| IUPAC Name | 5-cyclopropyl-4-[[1-[1-(2,4-dichlorophenyl)-2-methoxyethyl]piperidin-4-yl]methoxy]-2-fluoro-N-methylsulfanylbenzamide;ethane |
| SMILES | CC.CC.COCC(c1ccc(Cl)cc1Cl)N1CCC(COc2cc(F)c(C(=O)NSC)cc2C2CC2)CC1 |
| InChI | InChI=1S/C26H31Cl2FN2O3S.2C2H6/c1-33-15-24(19-6-5-18(27)11-22(19)28)31-9-7-16(8-10-31)14-34-25-13-23(29)21(26(32)30-35-2)12-20(25)17-3-4-17;2*1-2/h5-6,11-13,16-17,24H,3-4,7-10,14-15H2,1-2H3,(H,30,32);2*1-2H3 |
| InChIKey | UVADLLFTECETFA-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.66 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|