C23H26BrClFN3O3S2 — CID 144850037
4-[[1-(4-bromo-3-chloro-N-hydroxyanilino)sulfanylpiperidin-4-yl]methoxy]-5-cyclopropyl-2-fluoro-N-methylsulfanylbenzamide (PubChem CID 144850037) has the molecular formula C23H26BrClFN3O3S2 and a molecular weight of 590.97 g/mol. Its IUPAC name is 4-[[1-(4-bromo-3-chloro-N-hydroxyanilino)sulfanylpiperidin-4-yl]methoxy]-5-cyclopropyl-2-fluoro-N-methylsulfanylbenzamide.
| Compound Name | 4-[[1-(4-bromo-3-chloro-N-hydroxyanilino)sulfanylpiperidin-4-yl]methoxy]-5-cyclopropyl-2-fluoro-N-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 144850037 |
| Molecular Formula | C23H26BrClFN3O3S2 |
| Molecular Weight | 590.97 g/mol |
| Exact Mass | 589.03 |
| IUPAC Name | 4-[[1-(4-bromo-3-chloro-N-hydroxyanilino)sulfanylpiperidin-4-yl]methoxy]-5-cyclopropyl-2-fluoro-N-methylsulfanylbenzamide |
| SMILES | CSNC(=O)c1cc(C2CC2)c(OCC2CCN(SN(O)c3ccc(Br)c(Cl)c3)CC2)cc1F |
| InChI | InChI=1S/C23H26BrClFN3O3S2/c1-33-27-23(30)18-11-17(15-2-3-15)22(12-21(18)26)32-13-14-6-8-28(9-7-14)34-29(31)16-4-5-19(24)20(25)10-16/h4-5,10-12,14-15,31H,2-3,6-9,13H2,1H3,(H,27,30) |
| InChIKey | VCGJPRUTQLYYTA-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.97 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|